Products
2,4-Difluorobiphenyl
Synonyms:2,4-Difluorobiphenyl;37847-52-2;2,4-Difluoro-1,1'-biphenyl;2,4-difluoro-1-phenylbenzene;2,4-Difluoro-1,1-biphenyl;EINECS 253-690-2;1,1'-Biphenyl, 2,4-difluoro-;2,4-Difluoro-biphenyl;2',4'-difluorobiphenyl;2,4-Difluorophenylbenzene;SCHEMBL412228;CHEMBL121977;JVHAJKHGPDDEEU-UHFFFAOYSA-;DTXSID70191277;MFCD00042515;AKOS006230003;2,4-Difluoro-1,1'-biphenyl, 97%;CS-W015898;AC-10689;AS-13070;D3450;FT-0610097;D90192;W-106508
Chemical Property of 2,4-Difluorobiphenyl
● Appearance/Colour:White crystal
● Vapor Pressure:17.5mmHg at 25°C
● Melting Point:63 °C
● Refractive Index:1.377
● Boiling Point:243.7 °C at 760 mmHg
● Flash Point:83 °C
● PSA：0.00000
● Density:1.165 g/cm3
● LogP:3.63180
● Storage Temp.:2-8°C
● Solubility.:Acetonitrile (Slightly), Chloroform (Slightly)
● XLogP3:4.2
● Hydrogen Bond Donor Count:0
● Hydrogen Bond Acceptor Count:2
● Rotatable Bond Count:1
● Exact Mass:190.05940658
● Heavy Atom Count:14
● Complexity:175
Safty Information
● Pictogram(s):
Xi
● Hazard Codes:Xi,N,Xn
● Statements:36/37/38-50/53-41-37/38-22
● Safety Statements:20/21-24/25-61-60-39-26
Useful
Canonical SMILES:C1=CC=C(C=C1)C2=C(C=C(C=C2)F)F
Uses:2,4-Difluorobiphenyl is used in preparation of blue light-excitable orange red cationic iridium(III) complex for LED.
Detailed Introduction
2,4-Difluorobiphenyl is a chemical compound with the molecular formula C12H8F2. It belongs to the class of biphenyl derivatives, which are aromatic compounds composed of two benzene rings connected by a single bond. In the case of 2,4-Difluorobiphenyl, two of the hydrogen atoms in the biphenyl structure have been replaced by fluorine atoms.
This compound is known for its diverse applications in various industries. One of its chief uses is in the field of pharmaceuticals. 2,4-Difluorobiphenyl serves as an intermediate in the synthesis of pharmaceutical compounds.
By undergoing various chemical reactions, it can be transformed into more complex molecules with specific medicinal properties.
In addition to its role in pharmaceutical research, 2,4-Difluorobiphenyl also finds utility in organic synthesis. It can act as a building block or starting material in the production of other organic compounds. Through a range of reactions, it can be transformed into different derivatives, allowing chemists to modify and manipulate the structure to achieve desired properties.
Furthermore, 2,4-Difluorobiphenyl is used in the field of material science. Its unique chemical structure makes it attractive for the synthesis of polymers and materials with enhanced properties. It can serve as a monomer, participating in polymerization processes to create materials with improved thermal stability, mechanical strength, or other desirable characteristics.
In summary, 2,4-Difluorobiphenyl holds significance in pharmaceutical research, organic synthesis, and material science. Its versatility as a starting material or intermediate compound makes it valuable in these fields, offering opportunities for the development of new drugs, materials, and chemical processes.
Application
2,4-Difluorobiphenyl is an organic compound belonging to the class of biphenyl derivatives. It is used in various applications, including:
Pharmaceutical Intermediates: 2,4-Difluorobiphenyl can be used as an intermediate in the synthesis of pharmaceutical compounds. It can undergo various chemical reactions to introduce other functional groups and modify the structure to obtain desired pharmacological properties.
Organic Synthesis: This compound can be employed as a building block or starting material in organic synthesis. It can participate in cross-coupling reactions, Suzuki-Miyaura couplings, and other carbon-carbon bond-forming reactions to construct more complex organic molecules.
Liquid Crystals: 2,4-Difluorobiphenyl exhibits liquid crystalline properties. Liquid crystals have applications in display technologies, such as liquid crystal displays (LCDs) and organic light-emitting diodes (OLEDs). They provide enhanced optical performance and can be employed in various electronic devices.
Chemical Research: Researchers may use 2,4-Difluorobiphenyl as a reagent or reference compound in chemical research and analysis. It can be used as a standard for chromatographic techniques, such as gas chromatography (GC) or liquid chromatography (LC), to determine the presence and concentration of other compounds.
Material Science: Due to its unique chemical structure, 2,4-Difluorobiphenyl can be utilized in materials science and polymer chemistry. It can act as a monomer for the synthesis of polymers with specific characteristics, such as improved thermal stability or enhanced mechanical properties.
Overall, 2,4-Difluorobiphenyl finds applications in pharmaceutical intermediates, organic synthesis, liquid crystals, chemical research, and material science. Its versatility makes it useful in various fields, contributing to advancements in different industries.
